83803-79-6 Usage
General Description
The chemical compound known as "[4-[[4-anilino-1-naphthyl][4-(dimethylamino)phenyl]methylene]cyclohexa-2,5-dien-1-ylidene]dimethylammonium acetate" is a complex organic molecule with potential usage in various organic reactions due to its conjugated systems and multiple functional groups. Its structure includes phenyl, naphthyl, dimethylamino, and acetate groups. As an ammonium compound, it may also exhibit properties similar to both amines and quaternary ammonium salts. The acetate component indicates it is the salt of acetic acid. Because of its complex structure, this substance can potentially participate in a broad range of chemical reactions, making it significant for studies in organic chemistry. However, specific applications and properties of this compound may depend on its physical form and reaction conditions, and may not be well-documented given its complexity.
Check Digit Verification of cas no
The CAS Registry Mumber 83803-79-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,8,0 and 3 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 83803-79:
(7*8)+(6*3)+(5*8)+(4*0)+(3*3)+(2*7)+(1*9)=146
146 % 10 = 6
So 83803-79-6 is a valid CAS Registry Number.
InChI:InChI=1/C33H31N3.C2H4O2/c1-35(2)27-18-14-24(15-19-27)33(25-16-20-28(21-17-25)36(3)4)31-22-23-32(30-13-9-8-12-29(30)31)34-26-10-6-5-7-11-26;1-2(3)4/h5-23H,1-4H3;1H3,(H,3,4)/b34-32+;