84434-66-2 Usage
Property
Quaternary Ammonium Compound
Property
Complex Structure
Property
Fluorescent Dye
Property
Molecule Labeling and Tracking
Property
Suitable for Staining and Colorimetric Assays
Explanation
The chemical structure of 2-[3-(3-ethyl-3H-benzothiazol-2-ylidene)-2-methylprop-1-enyl]-3-(2-hydroxyethyl)benzothiazolium bromide contains a positively charged nitrogen atom, which classifies it as a quaternary ammonium compound.
Explanation
The compound has a benzothiazolium core with various substituents, including an ethyl group, a methylprop-1-enyl group, and a hydroxyethyl group, making its structure complex.
Explanation
This compound is used as a fluorescent dye in biological and chemical research, as well as in medical diagnostics, due to its ability to emit light when excited by specific wavelengths.
Explanation
The emission of light when excited allows the compound to be used for labeling and tracking specific molecules in cells and tissues, providing valuable information for research and diagnostics.
Explanation
The chemical structure and properties of 2-[3-(3-ethyl-3H-benzothiazol-2-ylidene)-2-methylprop-1-enyl]-3-(2-hydroxyethyl)benzothiazolium bromide make it suitable for use in staining and colorimetric assays, which are essential techniques in various scientific fields.
Check Digit Verification of cas no
The CAS Registry Mumber 84434-66-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,4,3 and 4 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 84434-66:
(7*8)+(6*4)+(5*4)+(4*3)+(3*4)+(2*6)+(1*6)=142
142 % 10 = 2
So 84434-66-2 is a valid CAS Registry Number.
InChI:InChI=1/C22H23N2OS2.BrH/c1-3-23-17-8-4-6-10-19(17)26-21(23)14-16(2)15-22-24(12-13-25)18-9-5-7-11-20(18)27-22;/h4-11,14-15,25H,3,12-13H2,1-2H3;1H/q+1;/p-1