850375-15-4 Usage
Description
(1,4-DIMETHYL-1,2,3,4-TETRAHYDROQUINOXALIN-6-YL)METHYLAMINE is a chemical compound characterized by the molecular formula C12H18N2. It features a tetrahydroquinoxaline ring structure with two methyl groups and a methylamine moiety, classifying it as a tertiary amine. This unique structural composition may endow it with potential applications in the realms of organic synthesis and medicinal chemistry, given its possible biological activity. However, further research and testing are essential to elucidate its full properties and potential uses.
Uses
As the provided materials do not specify particular applications for (1,4-DIMETHYL-1,2,3,4-TETRAHYDROQUINOXALIN-6-YL)METHYLAMINE, the following uses are inferred based on its potential in organic synthesis and medicinal chemistry:
Used in Organic Synthesis:
(1,4-DIMETHYL-1,2,3,4-TETRAHYDROQUINOXALIN-6-YL)METHYLAMINE is used as a synthetic intermediate for the creation of various organic compounds due to its unique tetrahydroquinoxaline ring and methylamine functional groups.
Used in Medicinal Chemistry:
(1,4-DIMETHYL-1,2,3,4-TETRAHYDROQUINOXALIN-6-YL)METHYLAMINE is used as a potential pharmaceutical agent for the development of new drugs, leveraging its distinctive structure and possible biological activity.
Check Digit Verification of cas no
The CAS Registry Mumber 850375-15-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,3,7 and 5 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 850375-15:
(8*8)+(7*5)+(6*0)+(5*3)+(4*7)+(3*5)+(2*1)+(1*5)=164
164 % 10 = 4
So 850375-15-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H17N3/c1-13-5-6-14(2)11-7-9(8-12)3-4-10(11)13/h3-4,7H,5-6,8,12H2,1-2H3
