85099-06-5 Usage
General Description
[(2-hydroxytetradecyl)thio]acetic acid is a chemical compound that contains a hydroxy group and a thioether group. It is a long-chain fatty acid derivative that has applications in biological and pharmaceutical research due to its potential as a drug delivery agent. The compound has been studied for its anti-inflammatory and antioxidant properties, making it a potential candidate for the treatment of various medical conditions. Additionally, it has been investigated for its potential use in controlling the release of drugs in the body and enhancing their therapeutic effects. Overall, [(2-hydroxytetradecyl)thio]acetic acid has shown promise as a versatile compound with potential therapeutic applications in medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 85099-06-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,0,9 and 9 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 85099-06:
(7*8)+(6*5)+(5*0)+(4*9)+(3*9)+(2*0)+(1*6)=155
155 % 10 = 5
So 85099-06-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H32O3S/c1-2-3-4-5-6-7-8-9-10-11-12-15(17)13-20-14-16(18)19/h15,17H,2-14H2,1H3,(H,18,19)
