852180-57-5 Usage
General Description
N-(4-piperidin-1-ylbenzyl)propan-2-amine is a chemical compound with the molecular formula C18H28N2. It is an organic compound that consists of a piperidine ring, a benzyl group, and a propan-2-amine group. N-(4-PIPERIDIN-1-YLBENZYL)PROPAN-2-AMINE is commonly used in medicinal chemistry as a building block for the synthesis of various pharmaceuticals. It may also have potential applications in research and development of new drugs, as well as in the synthesis of other organic compounds. Additionally, it may have biological and pharmacological properties that make it of interest for further study and potential use in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 852180-57-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,2,1,8 and 0 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 852180-57:
(8*8)+(7*5)+(6*2)+(5*1)+(4*8)+(3*0)+(2*5)+(1*7)=165
165 % 10 = 5
So 852180-57-5 is a valid CAS Registry Number.
InChI:InChI=1/C15H24N2/c1-13(2)16-12-14-6-8-15(9-7-14)17-10-4-3-5-11-17/h6-9,13,16H,3-5,10-12H2,1-2H3