85462-60-8 Usage
General Description
4,5-DIFLUORO-2-METHYLINDOLE is a chemical compound with the molecular formula C9H7F2N. It is a substituted indole derivative that contains two fluorine atoms and a methyl group. 4,5-DIFLUORO-2-METHYLINDOLE is used in organic synthesis and pharmaceutical research due to its potential as a building block for the synthesis of various biologically active molecules. It has been studied for its potential pharmacological properties, including its ability to act as an inhibitor of certain enzymes and receptors. Additionally, 4,5-DIFLUORO-2-METHYLINDOLE has been investigated for its potential use in the development of new drugs for the treatment of various medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 85462-60-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,4,6 and 2 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 85462-60:
(7*8)+(6*5)+(5*4)+(4*6)+(3*2)+(2*6)+(1*0)=148
148 % 10 = 8
So 85462-60-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H7F2N/c1-5-4-6-8(12-5)3-2-7(10)9(6)11/h2-4,12H,1H3
