85711-93-9 Usage
Description
(S)-1-(4-bromobenzoyl)-N,N-dimethyl-5-oxopyrrolidine-2-carboxamide is a chemical compound that belongs to the class of pyrrolidine-2-carboxamides. It features a pyrrolidine ring with a 4-bromobenzoyl and N,N-dimethyl amide group attached to it. This unique structure and its properties make it suitable for various applications, including pharmaceuticals, agrochemicals, and material sciences. Its potential for drug discovery and design, as well as other industrial and research purposes, is currently being explored in ongoing studies and investigations.
Uses
Used in Pharmaceutical Industry:
(S)-1-(4-bromobenzoyl)-N,N-dimethyl-5-oxopyrrolidine-2-carboxamide is used as a potential candidate for drug discovery and design due to its unique chemical structure and properties. It may contribute to the development of new medications for various therapeutic areas.
Used in Agrochemical Industry:
In the agrochemical field, (S)-1-(4-bromobenzoyl)-N,N-dimethyl-5-oxopyrrolidine-2-carboxamide is used for its potential applications in the development of new pesticides or other agrochemical products, leveraging its chemical properties to enhance crop protection and yield.
Used in Material Sciences:
(S)-1-(4-bromobenzoyl)-N,N-dimethyl-5-oxopyrrolidine-2-carboxamide is utilized in material sciences for its potential to contribute to the creation of new materials with specific properties, such as improved stability, reactivity, or other characteristics valuable in various industrial applications.
As ongoing research and development efforts continue, the potential uses and effects of (S)-1-(4-bromobenzoyl)-N,N-dimethyl-5-oxopyrrolidine-2-carboxamide are expected to expand, making it a promising area of study for future scientific and industrial advancements.
Check Digit Verification of cas no
The CAS Registry Mumber 85711-93-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,7,1 and 1 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 85711-93:
(7*8)+(6*5)+(5*7)+(4*1)+(3*1)+(2*9)+(1*3)=149
149 % 10 = 9
So 85711-93-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H15BrN2O3/c1-16(2)14(20)11-7-8-12(18)17(11)13(19)9-3-5-10(15)6-4-9/h3-6,11H,7-8H2,1-2H3