85819-28-9 Usage
Description
N-Acetyl-9-deoxy-9-fluoroneuraminic acid is a synthetic sialic acid derivative and a fluorinated analog of the naturally occurring sugar molecule. It is known for its ability to interact with sialic acid-binding proteins in the body, making it a valuable tool in both research and therapeutic settings for understanding and manipulating sialic acid-mediated processes.
Uses
Used in Pharmaceutical Industry:
N-Acetyl-9-deoxy-9-fluoroneuraminic acid is used as a key component in the development of drugs, particularly antiviral and anti-inflammatory agents. Its interaction with sialic acid-binding proteins contributes to its therapeutic potential in treating various diseases.
Used in Vaccine Development:
N-Acetyl-9-deoxy-9-fluoroneuraminic acid is utilized as a component in creating glycoconjugate vaccines. Its ability to mimic the structure of natural sialic acids allows for the development of vaccines that can target specific pathogens more effectively.
Used in Research:
N-Acetyl-9-deoxy-9-fluoroneuraminic acid serves as a valuable tool for probing the biological functions of sialic acid-containing molecules. Its unique structure and properties enable researchers to study the roles of sialic acids in various biological processes and diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 85819-28-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,8,1 and 9 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 85819-28:
(7*8)+(6*5)+(5*8)+(4*1)+(3*9)+(2*2)+(1*8)=169
169 % 10 = 9
So 85819-28-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H18FNO8/c1-4(14)13-8(5(15)2-6(16)11(20)21)10(19)9(18)7(17)3-12/h5,7-10,15,17-19H,2-3H2,1H3,(H,13,14)(H,20,21)/t5-,7+,8+,9+,10+/m0/s1
