858841-53-9 Usage
Description
4-BROMO-3-IODOTOLUENE is an organic compound that consists of a toluene molecule with a bromine atom at the 4th position and an iodine atom at the 3rd position. It is a halogenated aromatic compound with unique chemical properties due to the presence of both bromine and iodine atoms.
Uses
Used in Pharmaceutical Synthesis:
4-BROMO-3-IODOTOLUENE is used as a reagent in pharmaceutical synthesis for the production of various drugs and medicinal compounds. Its unique structure allows for specific chemical reactions that are essential in the synthesis of certain pharmaceuticals.
Used in Graphene Nanoribbons Synthesis:
4-BROMO-3-IODOTOLUENE is also used in the synthesis of graphene nanoribbons with near-infrared absorption. Graphene nanoribbons are narrow strips of graphene that exhibit unique electronic and optical properties. The incorporation of 4-BROMO-3-IODOTOLUENE in their synthesis allows for the creation of nanoribbons with enhanced near-infrared absorption, which can be useful in various applications such as photovoltaics, sensors, and optoelectronics.
Check Digit Verification of cas no
The CAS Registry Mumber 858841-53-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,8,8,4 and 1 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 858841-53:
(8*8)+(7*5)+(6*8)+(5*8)+(4*4)+(3*1)+(2*5)+(1*3)=219
219 % 10 = 9
So 858841-53-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H6BrI/c1-5-2-3-6(8)7(9)4-5/h2-4H,1H3
