86088-59-7 Usage
Description
L-Threonine benzyl ester hemioxalate is a chemical compound derived from L-threonine, an essential amino acid, and benzyl ester. It is characterized by the presence of a hemioxalate group, which is a cyclic ester formed by the reaction of an aldehyde with an ester. This unique structure makes it a valuable intermediate in the synthesis of various organic compounds.
Uses
Used in Pharmaceutical Industry:
L-Threonine benzyl ester hemioxalate is used as a reactant in the synthesis of Chlorofusin, a potent inhibitor of the p53-MDM2 complex formation. This complex plays a crucial role in regulating the cell cycle and apoptosis, and its inhibition can lead to the activation of the tumor suppressor protein p53, which in turn can induce cell cycle arrest and apoptosis in cancer cells. This makes Chlorofusin a promising candidate for the development of anticancer drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 86088-59-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,6,0,8 and 8 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 86088-59:
(7*8)+(6*6)+(5*0)+(4*8)+(3*8)+(2*5)+(1*9)=167
167 % 10 = 7
So 86088-59-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H15NO3.C2H2O4/c1-8(13)10(12)11(14)15-7-9-5-3-2-4-6-9;3-1(4)2(5)6/h2-6,8,10,13H,7,12H2,1H3;(H,3,4)(H,5,6)/t8-,10+;/m1./s1
