865546-36-7 Usage
Description
1-Pyridin-3-yl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine is a chemical compound characterized by a tetrahydropyrrolopyrazine structure with a pyridine group attached at position 3. This unique structure endows it with potential pharmacological properties, making it a valuable building block in the pharmaceutical industry for the synthesis of biologically active molecules. Its chemical properties and potential biological activities position it as a promising tool for researchers in medicinal chemistry and drug design.
Uses
Used in Pharmaceutical Industry:
1-Pyridin-3-yl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine is used as a building block for the synthesis of various biologically active molecules due to its unique tetrahydropyrrolopyrazine structure with a pyridine group. 1-PYRIDIN-3-YL-1,2,3,4-TETRAHYDROPYRROLO[1,2-A]PYRAZINE serves as a key component in the development of new drugs, contributing to the discovery and creation of novel therapeutic agents with potential applications in treating various diseases and conditions.
In Drug Discovery and Development:
1-Pyridin-3-yl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine is utilized for its potential pharmacological properties, which make it a valuable asset in drug discovery and development. Its unique structure allows for the exploration of new chemical entities and the enhancement of existing drug molecules, leading to improved efficacy, selectivity, and safety profiles in therapeutic interventions.
Check Digit Verification of cas no
The CAS Registry Mumber 865546-36-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,5,5,4 and 6 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 865546-36:
(8*8)+(7*6)+(6*5)+(5*5)+(4*4)+(3*6)+(2*3)+(1*6)=207
207 % 10 = 7
So 865546-36-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H13N3/c1-3-10(9-13-5-1)12-11-4-2-7-15(11)8-6-14-12/h1-5,7,9,12,14H,6,8H2
865546-36-7Relevant articles and documents
Substituted Sulfonamide Compounds
-
Page/Page column 35-36, (2009/07/25)
Substituted sulfonamide compounds corresponding to the formula I wherein m, n, p, Q, R1, R2, R3, R4, X, Y and Z have the respective meanings defined herein, pharmaceutical compositions containing such compounds, a process for their preparation, and the use of such compounds for the treatment and/or inhibition of pain and other conditions mediated by bradykinin receptor 1 (B1R) and/or bradykinin receptor 2 (B2R).