867006-20-0 Usage
General Description
3,9-Diazaspiro[5.5]undecan-2-one is a chemical compound that belongs to the class of organic compounds known as spiro compounds. It consists of a spiro skeleton, which is a bicyclic ring system that includes two rings that share a single atom. 3,9-Diazaspiro[5.5]undecan-2-one is a heterocyclic compound containing two nitrogen atoms. It is a colorless liquid and widely used in the pharmaceutical industry as a building block for the synthesis of various drugs and biologically active molecules. It has also been studied for its potential pharmacological properties, such as its anti-inflammatory and analgesic effects. Additionally, it has been investigated as a potential precursor for the synthesis of novel compounds with therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 867006-20-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,7,0,0 and 6 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 867006-20:
(8*8)+(7*6)+(6*7)+(5*0)+(4*0)+(3*6)+(2*2)+(1*0)=170
170 % 10 = 0
So 867006-20-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H16N2O/c12-8-7-9(3-6-11-8)1-4-10-5-2-9/h10H,1-7H2,(H,11,12)
