868543-19-5 Usage
General Description
2-MORPHOLIN-4-YLMETHYLBENZOIC ACID, also known as Erastin, is a chemical compound that has shown to exhibit anti-cancer properties. It functions by selectively inducing ferroptotic cell death in cancer cells with RAS mutations, while sparing normal cells. This makes it a potential candidate for developing targeted cancer therapies. Additionally, it has also been studied for its potential in treating neurodegenerative diseases, such as Huntington's disease, due to its ability to induce cell death in specific types of cells. Research on 2-MORPHOLIN-4-YLMETHYLBENZOIC ACID is ongoing, as scientists explore its potential applications in the field of medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 868543-19-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,8,5,4 and 3 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 868543-19:
(8*8)+(7*6)+(6*8)+(5*5)+(4*4)+(3*3)+(2*1)+(1*9)=215
215 % 10 = 5
So 868543-19-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H15NO3/c14-12(15)11-4-2-1-3-10(11)9-13-5-7-16-8-6-13/h1-4H,5-9H2,(H,14,15)