871125-72-3 Usage
General Description
4-ETHOXY-2,3,5,6-TETRAFLUOROBENZENEBORONIC ACID is a chemical compound with the molecular formula C8H7BFO4. It is a boronic acid derivative that contains a benzene ring with four fluorine atoms and an ethoxy group. 4-ETHOXY-2,3,5,6-TETRAFLUOROBENZENEBORONIC ACID is commonly used in organic and medicinal chemistry as a reagent for the synthesis of various pharmaceuticals, agrochemicals, and materials. It is also known for its ability to form stable complexes with diols and polyols, making it a valuable tool in the field of chemical analysis and bioconjugation. Additionally, 4-ETHOXY-2,3,5,6-TETRAFLUOROBENZENEBORONIC ACID has shown potential as a catalyst in various organic reactions and as a building block for the development of novel chemical entities.
Check Digit Verification of cas no
The CAS Registry Mumber 871125-72-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,1,2 and 5 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 871125-72:
(8*8)+(7*7)+(6*1)+(5*1)+(4*2)+(3*5)+(2*7)+(1*2)=163
163 % 10 = 3
So 871125-72-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H7BF4O3/c1-2-16-8-6(12)4(10)3(9(14)15)5(11)7(8)13/h14-15H,2H2,1H3