871125-75-6 Usage
Description
3-(3'-Methoxybenzyloxy)phenylboronic acid is a chemical compound that belongs to the class of boronic acids. It is commonly used in organic synthesis and pharmaceutical research. 3-(3'-METHOXYBENZYLOXY)PHENYLBORONIC AC& features a boronic acid group attached to a phenyl ring, which is further linked to a methoxybenzyl ether. Its unique structure and reactivity make it a valuable building block for creating complex organic molecules and potential drug candidates. Moreover, the boronic acid moiety allows for the formation of stable complexes with certain biomolecules, making it useful for biological studies and drug discovery.
Uses
Used in Organic Synthesis:
3-(3'-Methoxybenzyloxy)phenylboronic acid is used as a reagent in Suzuki-Miyaura cross-coupling reactions, a versatile method for forming carbon-carbon bonds. Its unique structure and reactivity make it a valuable building block for creating complex organic molecules.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 3-(3'-Methoxybenzyloxy)phenylboronic acid is used as a starting material for the development of potential drug candidates. Its boronic acid moiety allows for the formation of stable complexes with certain biomolecules, making it useful for biological studies and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 871125-75-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,1,2 and 5 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 871125-75:
(8*8)+(7*7)+(6*1)+(5*1)+(4*2)+(3*5)+(2*7)+(1*5)=166
166 % 10 = 6
So 871125-75-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H15BO4/c1-18-13-6-2-4-11(8-13)10-19-14-7-3-5-12(9-14)15(16)17/h2-9,16-17H,10H2,1H3
