88260-06-4 Usage
General Description
2-azabicyclo(2.2.1)heptane-3-carboxylic acid, also known as tropanyl-3-carboxylic acid, is a chemical compound with a bicyclic structure. It is a derivative of tropane with a carboxylic acid substituent at the 3-position. 2-azabicyclo(2.2.1)heptane-3-carboxylic acid is commonly used as a building block for the synthesis of various biologically active molecules, particularly pharmaceuticals. Its unique structure and functional groups make it a versatile intermediate in organic chemistry, allowing for the creation of diverse compounds with potential medical applications. Additionally, its rigid and stable bicyclic structure makes it an attractive scaffold for drug design and development.
Check Digit Verification of cas no
The CAS Registry Mumber 88260-06-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,8,2,6 and 0 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 88260-06:
(7*8)+(6*8)+(5*2)+(4*6)+(3*0)+(2*0)+(1*6)=144
144 % 10 = 4
So 88260-06-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H11NO2/c9-7(10)6-4-1-2-5(3-4)8-6/h4-6,8H,1-3H2,(H,9,10)
