88389-69-9 Usage
Description
Pro-opiomelanocortin joining peptide(14-23), also known as joining peptide, is a fragment derived from the pro-opiomelanocortin (POMC) precursor protein. It is a critical component in the synthesis of melanocyte-stimulating hormone (MSH), which plays a significant role in regulating pigmentation and energy metabolism. Additionally, joining peptide is involved in various neuroendocrine functions, including the regulation of stress response, immune function, and energy balance. It also exhibits anti-inflammatory and analgesic properties, making it a potential target for therapeutic intervention in various disease states. Overall, joining peptide is a multifunctional chemical with diverse biological roles in the body.
Uses
Used in Pharmaceutical Industry:
Pro-opiomelanocortin joining peptide(14-23) is used as a therapeutic agent for its anti-inflammatory and analgesic properties, making it a potential target for intervention in various disease states.
Used in Cosmetic Industry:
Pro-opiomelanocortin joining peptide(14-23) is used as a skin lightening agent for its role in regulating pigmentation.
Used in Research:
Pro-opiomelanocortin joining peptide(14-23) is used as a research tool to study the neuroendocrine functions, including the regulation of stress response, immune function, and energy balance.
Check Digit Verification of cas no
The CAS Registry Mumber 88389-69-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,8,3,8 and 9 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 88389-69:
(7*8)+(6*8)+(5*3)+(4*8)+(3*9)+(2*6)+(1*9)=199
199 % 10 = 9
So 88389-69-9 is a valid CAS Registry Number.
InChI:InChI=1/C43H72N14O14/c1-21(2)33(44)40(69)51-23(5)36(65)55-34(22(3)4)41(70)49-19-29(58)52-25(12-14-31(60)61)37(66)54-26(13-15-32(62)63)42(71)57-18-8-10-27(57)38(67)50-20-30(59)56-17-7-11-28(56)39(68)53-24(35(45)64)9-6-16-48-43(46)47/h21-28,33-34H,6-20,44H2,1-5H3,(H2,45,64)(H,49,70)(H,50,67)(H,51,69)(H,52,58)(H,53,68)(H,54,66)(H,55,65)(H,60,61)(H,62,63)(H4,46,47,48)/t23-,24-,25-,26-,27-,28-,33-,34-/m0/s1