884495-10-7 Usage
Description
4-BROMO-2-CHLORO-5-FLUOROPYRIDINE is a halogenated pyridine compound that serves as a versatile reagent in organic synthesis and medicinal chemistry. Its unique structure, featuring a combination of bromine, chlorine, and fluorine atoms, endows it with distinct chemical properties and reactivity, making it a valuable building block for the development of pharmaceuticals and other organic compounds.
Uses
Used in Pharmaceutical Industry:
4-BROMO-2-CHLORO-5-FLUOROPYRIDINE is used as a key intermediate in the synthesis of N-[8-(hetero)aryl-2-naphthoyl]guanidine derivatives, which are 5-HTA receptor modulators. These modulators have potential therapeutic applications in the treatment or prevention of various neurological and psychiatric disorders, such as dementia, schizophrenia, bipolar disorder, and other related diseases. 4-BROMO-2-CHLORO-5-FLUOROPYRIDINE's unique halogenated structure allows for the fine-tuning of the pharmacological properties of the resulting guanidine derivatives, enhancing their efficacy and selectivity as receptor modulators.
Check Digit Verification of cas no
The CAS Registry Mumber 884495-10-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,4,4,9 and 5 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 884495-10:
(8*8)+(7*8)+(6*4)+(5*4)+(4*9)+(3*5)+(2*1)+(1*0)=217
217 % 10 = 7
So 884495-10-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H2BrClFN/c6-3-1-5(7)9-2-4(3)8/h1-2H
