884504-41-0 Usage
Structure
Organic compound with a benzophenone structure
Functional Groups
Two methoxy groups (-OCH3) on the 2' and 4' positions
3-(1,3-dioxan-2-yl)propyl group
Applications
Synthesis of various pharmaceuticals
Building block in organic chemistry reactions
Potential Applications
Medicinal chemistry
Drug discovery
Caution
Handle with care due to potential health risks if not used properly
Versatility
Suitable for various scientific and industrial applications
Check Digit Verification of cas no
The CAS Registry Mumber 884504-41-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,4,5,0 and 4 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 884504-41:
(8*8)+(7*8)+(6*4)+(5*5)+(4*0)+(3*4)+(2*4)+(1*1)=190
190 % 10 = 0
So 884504-41-0 is a valid CAS Registry Number.
InChI:InChI=1/C15H20O5/c1-17-11-4-5-12(14(10-11)18-2)13(16)6-7-15-19-8-3-9-20-15/h4-5,10,15H,3,6-9H2,1-2H3