88912-23-6 Usage
Description
2,6-Difluoro-4-pyridinecarboxylic acid is an organic compound characterized by the presence of two fluorine atoms at the 2nd and 6th positions on a pyridine ring, with a carboxylic acid group attached at the 4th position. This unique molecular structure endows it with specific chemical properties and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
2,6-Difluoro-4-pyridinecarboxylic acid is used as a key intermediate in the synthesis of diphenoxypyridine derivatives, which possess Xa inhibitory activity. These derivatives are valuable in the development of antithrombotic drugs, targeting the inhibition of factor Xa, a crucial enzyme in the blood coagulation process. By inhibiting factor Xa, these compounds can help prevent the formation of blood clots, thereby reducing the risk of thrombotic disorders such as deep vein thrombosis, pulmonary embolism, and stroke.
Check Digit Verification of cas no
The CAS Registry Mumber 88912-23-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,8,9,1 and 2 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 88912-23:
(7*8)+(6*8)+(5*9)+(4*1)+(3*2)+(2*2)+(1*3)=166
166 % 10 = 6
So 88912-23-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H3F2NO2/c7-4-1-3(6(10)11)2-5(8)9-4/h1-2H,(H,10,11)
