893748-41-9 Usage
General Description
1-(4-Methoxyphenyl)-2,2-dimethylpiperazine is a chemical compound with the molecular formula C13H20N2O. It is a piperazine derivative, which is a class of organic compounds that have various pharmaceutical and industrial applications. This specific compound contains a piperazine ring with a 4-methoxyphenyl group attached to it, and two methyl groups at the 2 positions of the piperazine ring. The presence of the methoxy group makes it a phenethylamine, which is a class of compounds with potential psychoactive and pharmacological properties. Its chemical structure suggests potential use in the development of pharmaceuticals, such as antipsychotic or antidepressant drugs, due to its potential interaction with neurotransmitter systems in the brain. However, further research and testing would be necessary to fully understand its properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 893748-41-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,3,7,4 and 8 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 893748-41:
(8*8)+(7*9)+(6*3)+(5*7)+(4*4)+(3*8)+(2*4)+(1*1)=229
229 % 10 = 9
So 893748-41-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H20N2O/c1-13(2)10-14-8-9-15(13)11-4-6-12(16-3)7-5-11/h4-7,14H,8-10H2,1-3H3
