89446-58-2 Usage
General Description
2,4-Diamino-5-(bromomethyl)pyrimidine is a chemical compound with the molecular formula C6H7BrN4. It is a pyrimidine derivative with two amino groups and a bromomethyl substituent. 2,4-Diamino-5-(bromomethyl)pyrimidine is used in the synthesis of various pharmaceuticals and bioactive molecules. It can also be used as a building block in organic synthesis and in the development of new materials. Additionally, 2,4-Diamino-5-(bromomethyl)pyrimidine has potential applications in the field of medicinal chemistry, particularly in the development of new drugs for various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 89446-58-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,4,4 and 6 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 89446-58:
(7*8)+(6*9)+(5*4)+(4*4)+(3*6)+(2*5)+(1*8)=182
182 % 10 = 2
So 89446-58-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H7BrN4.2BrH/c6-1-3-2-9-5(8)10-4(3)7;;/h2H,1H2,(H4,7,8,9,10);2*1H