898754-84-2 Usage
General Description
2',4'-DIMETHYL-3-(2,6-DIMETHYLPHENYL)PROPIOPHENONE is a chemical compound with the molecular formula C18H22O. It is a propiophenone derivative with two methyl groups at positions 2 and 4, and a 2,6-dimethylphenyl group at position 3. 2',4'-DIMETHYL-3-(2,6-DIMETHYLPHENYL)PROPIOPHENONE is commonly used in the synthesis of various pharmaceuticals and organic compounds due to its versatile reactivity and potential biological activities. It is also used as a building block in the production of fragrances, dyes, and other fine chemicals. Additionally, 2',4'-DIMETHYL-3-(2,6-DIMETHYLPHENYL)PROPIOPHENONE may have potential applications in the fields of medicine, biochemistry, and materials science due to its unique chemical structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 898754-84-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,5 and 4 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 898754-84:
(8*8)+(7*9)+(6*8)+(5*7)+(4*5)+(3*4)+(2*8)+(1*4)=262
262 % 10 = 2
So 898754-84-2 is a valid CAS Registry Number.
InChI:InChI=1/C19H22O/c1-13-8-9-18(16(4)12-13)19(20)11-10-17-14(2)6-5-7-15(17)3/h5-9,12H,10-11H2,1-4H3
