898756-06-4 Usage
General Description
2',4'-DIMETHOXY-4-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)BUTYROPHENONE is a synthetic chemical compound with a complex molecular structure, consisting of two methoxy groups and a 4-(5,5-dimethyl-1,3-dioxan-2-yl)butyrophenone moiety. 2',4'-DIMETHOXY-4-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)BUTYROPHENONE is not commonly found in nature and is often synthesized in a laboratory setting. It is used in research and industrial applications, particularly in the development of new pharmaceuticals and agrochemicals. Additionally, 2',4'-DIMETHOXY-4-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)BUTYROPHENONE may have potential applications in the field of materials science and organic chemistry due to its unique structure and properties. However, further research is needed to fully understand its potential uses and effects.
Check Digit Verification of cas no
The CAS Registry Mumber 898756-06-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,5 and 6 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 898756-06:
(8*8)+(7*9)+(6*8)+(5*7)+(4*5)+(3*6)+(2*0)+(1*6)=254
254 % 10 = 4
So 898756-06-4 is a valid CAS Registry Number.
InChI:InChI=1/C18H26O5/c1-18(2)11-22-17(23-12-18)7-5-6-15(19)14-9-8-13(20-3)10-16(14)21-4/h8-10,17H,5-7,11-12H2,1-4H3
