898756-08-6 Usage
General Description
2',4'-DIMETHOXY-5-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)VALEROPHENONE, also known as 5-(2,4-dimethoxyphenyl)-2,2-dimethyl-1,3-dioxane-5-carboxaldehyde, is a chemical compound with potential pharmaceutical applications. It is a valerophenone derivative with two methoxy groups at the 2' and 4' positions of the phenyl ring, and a 5-(5,5-dimethyl-1,3-dioxan-2-yl) group attached to the carbon chain. 2',4'-DIMETHOXY-5-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)VALEROPHENONE is of interest in medicinal chemistry due to its potential as a pharmacophore for drug design, particularly in the development of novel treatments for various diseases and conditions. It exhibits unique structural and chemical properties that make it a promising candidate for further research and development in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 898756-08-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,5 and 6 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 898756-08:
(8*8)+(7*9)+(6*8)+(5*7)+(4*5)+(3*6)+(2*0)+(1*8)=256
256 % 10 = 6
So 898756-08-6 is a valid CAS Registry Number.
InChI:InChI=1/C19H28O5/c1-19(2)12-23-18(24-13-19)8-6-5-7-16(20)15-10-9-14(21-3)11-17(15)22-4/h9-11,18H,5-8,12-13H2,1-4H3