898759-91-6 Usage
Heterocyclic compound
A compound that contains a ring structure with at least one heteroatom, which is an atom other than carbon, such as nitrogen or oxygen. In the case of 2-(4-CYANOBENZOYL)OXAZOLE, it contains both a benzoyl and oxazole functional group.
Building block in the synthesis of pharmaceuticals and agrochemicals
2-(4-CYANOBENZOYL)OXAZOLE is commonly used as a starting material or building block in the synthesis of various pharmaceuticals and agrochemicals, which are chemicals used in the production of pesticides and fertilizers.
Precursor in research and development
2-(4-CYANOBENZOYL)OXAZOLE is used as a precursor in research and development to create a diverse range of compounds with various biological activities. A precursor is a compound that can be used as a starting material to create other compounds through chemical reactions.
Valuable intermediate in organic synthesis
2-(4-CYANOBENZOYL)OXAZOLE is a valuable intermediate in organic synthesis, meaning that it is a useful compound that can be used to create other compounds through chemical reactions. This makes it widely used in the development of new drugs and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 898759-91-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,5 and 9 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 898759-91:
(8*8)+(7*9)+(6*8)+(5*7)+(4*5)+(3*9)+(2*9)+(1*1)=276
276 % 10 = 6
So 898759-91-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H6N2O2/c12-7-8-1-3-9(4-2-8)10(14)11-13-5-6-15-11/h1-6H
