898778-92-2 Usage
Molecular structure
A complex organic compound containing a thiophene ring substituted with a dichlorobenzoyl and dioxolan-2-yl groups.
Thiophene ring
A five-membered heterocyclic compound containing sulfur, which imparts unique chemical and physical properties to the molecule.
Dichlorobenzoyl group
Adds electron-withdrawing properties to the compound, affecting its reactivity and interactions with other molecules.
Applications
Potential applications in organic synthesis, pharmaceuticals, or materials science due to its unique properties and reactivity.
Complexity
As a complex organic compound, it may require specialized techniques and methods for synthesis and analysis.
Reactivity
The presence of electron-withdrawing and reactive groups may result in unique chemical reactions and properties.
Potential for further research
Due to its unique structure and properties, 2-(2,6-dichlorobenzoyl)-5-(1,3-dioxolan-2-yl)thiophene may be of interest for further study and development in various scientific fields.
Check Digit Verification of cas no
The CAS Registry Mumber 898778-92-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,7 and 8 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 898778-92:
(8*8)+(7*9)+(6*8)+(5*7)+(4*7)+(3*8)+(2*9)+(1*2)=282
282 % 10 = 2
So 898778-92-2 is a valid CAS Registry Number.
InChI:InChI=1/C14H10Cl2O3S/c15-8-2-1-3-9(16)12(8)13(17)10-4-5-11(20-10)14-18-6-7-19-14/h1-5,14H,6-7H2
