898789-67-8 Usage
Main properties
1. UV absorber
2. Stabilizer
3. Potential for use in pharmaceuticals and medical devices
Specific content
1. Chemical compound name: 3-METHOXY-3'-(3-PYRROLINOMETHYL) BENZOPHENONE
2. Commonly used in: sunscreens, cosmetics, plastics
3. Function: protect materials from harmful effects of UV radiation
4. Benefits: absorb and dissipate UV energy, prevent color fading and degradation
5. Research: potential use in pharmaceuticals and medical devices
6. Safety: important to use according to recommended guidelines to avoid adverse effects on human health and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 898789-67-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,8 and 9 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 898789-67:
(8*8)+(7*9)+(6*8)+(5*7)+(4*8)+(3*9)+(2*6)+(1*7)=288
288 % 10 = 8
So 898789-67-8 is a valid CAS Registry Number.
InChI:InChI=1/C19H19NO2/c1-22-18-9-5-8-17(13-18)19(21)16-7-4-6-15(12-16)14-20-10-2-3-11-20/h2-9,12-13H,10-11,14H2,1H3