904813-60-1 Usage
Derivative of pyridine
This means that the compound is based on the pyridine molecule, which is a six-membered aromatic heterocyclic compound.
Contains an aminobutylamine side chain
This is a chain of atoms that is attached to the pyridine ring and contains both amino and butyl groups.
Contains a carboxylic acid functional group
This is a group of atoms within the molecule that has acidic properties and is responsible for the compound's ability to form salts and esters.
Not naturally occurring
This means that the compound is not found in nature and is synthesized in a laboratory.
Used in scientific research and pharmaceutical development
This indicates that the compound is used for various purposes in the field of science and medicine, such as studying its properties and testing its potential as a drug.
Studied for its potential pharmacological properties
This means that researchers are interested in the potential effects that the compound may have on the body and its possible uses as a medicine.
Has potential as an anti-inflammatory and anti-cancer agent
This means that the compound has been studied for its ability to reduce inflammation and inhibit the growth of cancer cells.
Versatile compound for various research and applications in the field of chemistry and medicine
This means that the compound's structure and properties make it useful for a wide range of scientific and medical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 904813-60-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,4,8,1 and 3 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 904813-60:
(8*9)+(7*0)+(6*4)+(5*8)+(4*1)+(3*3)+(2*6)+(1*0)=161
161 % 10 = 1
So 904813-60-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H15N3O2/c11-5-1-2-6-12-9-8(10(14)15)4-3-7-13-9/h3-4,7H,1-2,5-6,11H2,(H,12,13)(H,14,15)
