913836-03-0 Usage
General Description
5-Carboxypyridine-3-boronic acid is a chemical compound that consists of a pyridine ring with a carboxyl group and a boronic acid group attached to it. It is often used as a building block in organic synthesis and medicinal chemistry. The boronic acid group allows it to participate in Suzuki-Miyaura coupling reactions, which are widely used in the formation of carbon-carbon bonds. 5-CARBOXYPYRIDINE-3-BORONIC ACID is also known for its potential application in the development of new pharmaceutical drugs, as the boronic acid moiety can interact with certain biological targets. Additionally, 5-carboxypyridine-3-boronic acid has been studied for its potential use in the development of fluorescent probes for imaging biological systems.
Check Digit Verification of cas no
The CAS Registry Mumber 913836-03-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,3,8,3 and 6 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 913836-03:
(8*9)+(7*1)+(6*3)+(5*8)+(4*3)+(3*6)+(2*0)+(1*3)=170
170 % 10 = 0
So 913836-03-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H6BNO4/c9-6(10)4-1-5(7(11)12)3-8-2-4/h1-3,11-12H,(H,9,10)
