916422-59-8 Usage
Description
4-Amino-1-(4-chloro-benzyl)-piperidine-4-carboxylic acid methyl ester dihydrochloride is a chemical compound that features a piperidine ring with an amino group at the 4-position and a methyl ester group at the carboxylic acid group. It also includes a 4-chloro-benzyl moiety attached to the piperidine ring. The dihydrochloride salt form offers enhanced stability and solubility in aqueous solutions. 4-Amino-1-(4-chloro-benzyl)-piperidine-4-carboxylic acid methyl ester dihydrochloride holds promise in medicinal chemistry, particularly for the development of pharmaceutical drugs, due to its diverse structure and potential biological activities.
Uses
Used in Pharmaceutical Development:
4-Amino-1-(4-chloro-benzyl)-piperidine-4-carboxylic acid methyl ester dihydrochloride is utilized as a key intermediate in the synthesis of various pharmaceutical drugs. Its unique structure allows for the creation of molecules with specific biological activities, making it a valuable component in drug discovery and development processes.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 4-Amino-1-(4-chloro-benzyl)-piperidine-4-carboxylic acid methyl ester dihydrochloride serves as a versatile building block for the design and synthesis of novel compounds with potential therapeutic applications. Its presence in a molecule can influence pharmacokinetic and pharmacodynamic properties, contributing to the optimization of drug candidates.
Further research and investigation are necessary to fully understand the properties and potential uses of 4-Amino-1-(4-chloro-benzyl)-piperidine-4-carboxylic acid methyl ester dihydrochloride, as its diverse structure and potential biological activities may lead to new discoveries and applications in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 916422-59-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,6,4,2 and 2 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 916422-59:
(8*9)+(7*1)+(6*6)+(5*4)+(4*2)+(3*2)+(2*5)+(1*9)=168
168 % 10 = 8
So 916422-59-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H19ClN2O2.2ClH/c1-19-13(18)14(16)6-8-17(9-7-14)10-11-2-4-12(15)5-3-11;;/h2-5H,6-10,16H2,1H3;2*1H
