916813-19-9 Usage
General Description
N-(3-amino-4-chlorophenyl)-2-methylpropanamide is a chemical compound with the molecular formula C10H13ClN2O. It is an organic compound that contains an amide functional group and a chlorophenyl group. N-(3-amino-4-chlorophenyl)-2-methylpropanamide is commonly used in pharmaceutical research and development as a potential drug candidate due to its diverse pharmacological properties. Additionally, it has shown potential as an antibacterial and antifungal agent. Its specific chemical structure and properties make it of interest for further studies and potential applications in the medical and pharmaceutical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 916813-19-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,6,8,1 and 3 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 916813-19:
(8*9)+(7*1)+(6*6)+(5*8)+(4*1)+(3*3)+(2*1)+(1*9)=179
179 % 10 = 9
So 916813-19-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H13ClN2O/c1-6(2)10(14)13-7-3-4-8(11)9(12)5-7/h3-6H,12H2,1-2H3,(H,13,14)
916813-19-9Relevant articles and documents
NOVEL CHEMICAL COMPOUNDS
-
Page/Page column 68, (2010/11/25)
This invention relates to newly identified compounds for inhibiting hYAK3 proteins and methods for treating diseases associated with hYAK3 activity.