93408-07-2 Usage
Purine base
Contains a purine base
Amino group
Has an amino group attached to the purine base
Benzylsulfanyl group
Connected to a benzylsulfanyl group
Chlorophenyl group
Contains a chlorophenyl group
Hydroxymethyl group
Has a hydroxymethyl group attached to an oxolane ring
Potential biological activity
Likely to have biological activity
Nucleoside analog
Could potentially function as a nucleoside analog
Interference with DNA/RNA synthesis
May interfere with DNA or RNA synthesis
Requires further research
Specific function and potential uses need to be determined through further research and testing.
Check Digit Verification of cas no
The CAS Registry Mumber 93408-07-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,4,0 and 8 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 93408-07:
(7*9)+(6*3)+(5*4)+(4*0)+(3*8)+(2*0)+(1*7)=132
132 % 10 = 2
So 93408-07-2 is a valid CAS Registry Number.
InChI:InChI=1/C17H18ClN5O4S/c18-9-3-1-8(2-4-9)6-28-15-11-14(21-17(19)22-15)23(7-20-11)16-13(26)12(25)10(5-24)27-16/h1-4,7,10,12-13,16,24-26H,5-6H2,(H2,19,21,22)