93511-94-5 Usage
Description
(2S)-2-[[(2S)-1-[(2S)-1-[2-[[(2S)-2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2 -[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diamino methylideneamino)pentanoyl]amino]hexanoyl]amino]propanoyl]amino]-3-hydroxy-propanoyl]amino]acetyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]-3-methyl-butanoic acid is a complex peptide consisting of a specific sequence of amino acids linked together to form a long chain. Its highly specific structure suggests that it may have biological activity and be involved in various biochemical processes within living organisms.
Uses
1. Used in Pharmaceutical Industry:
(2S)-2-[[(2S)-1-[(2S)-1-[2-[[(2S)-2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2 -[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diamino methylideneamino)pentanoyl]amino]hexanoyl]amino]propanoyl]amino]-3-hydroxy-propanoyl]amino]acetyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]-3-methyl-butanoic acid may be used as a pharmaceutical agent for its potential biological activity and involvement in biochemical processes.
2. Used in Research and Development:
This complex peptide can be utilized in research and development for studying its structure, function, and potential applications in various biological systems.
3. Used in Diagnostics:
Due to its specific structure and potential biological activity, (2S)-2-[[(2S)-1-[(2S)-1-[2-[[(2S)-2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2 -[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diamino methylideneamino)pentanoyl]amino]hexanoyl]amino]propanoyl]amino]-3-hydroxy-propanoyl]amino]acetyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]-3-methyl-butanoic acid may be employed in the development of diagnostic tools to detect or monitor specific biological processes or conditions.
4. Used in Therapeutic Applications:
Given its potential biological activity, this complex peptide may be explored for its therapeutic potential in treating various diseases or conditions by modulating specific biochemical pathways.
Note: The specific applications and industries mentioned above are hypothetical and provided as examples based on the general properties of complex peptides. Further research and development would be required to determine the actual uses and efficacy of (2S)-2-[[(2S)-1-[(2S)-1-[2-[[(2S)-2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2 -[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diamino methylideneamino)pentanoyl]amino]hexanoyl]amino]propanoyl]amino]-3-hydroxy-propanoyl]amino]acetyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]-3-methyl-butanoic acid.
Check Digit Verification of cas no
The CAS Registry Mumber 93511-94-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,5,1 and 1 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 93511-94:
(7*9)+(6*3)+(5*5)+(4*1)+(3*1)+(2*9)+(1*4)=135
135 % 10 = 5
So 93511-94-5 is a valid CAS Registry Number.
InChI:InChI=1/C41H74N16O11/c1-22(2)31(39(67)68)55-37(65)28-13-8-19-57(28)38(66)29-14-9-18-56(29)30(59)20-50-34(62)27(21-58)54-32(60)23(3)51-35(63)25(11-4-5-15-42)53-36(64)26(12-7-17-49-41(46)47)52-33(61)24(43)10-6-16-48-40(44)45/h22-29,31,58H,4-21,42-43H2,1-3H3,(H,50,62)(H,51,63)(H,52,61)(H,53,64)(H,54,60)(H,55,65)(H,67,68)(H4,44,45,48)(H4,46,47,49)/t23-,24-,25-,26-,27-,28-,29-,31-/m0/s1