93514-84-2 Usage
Description
4-Hydroxy-5,7-dimethyl-quinoline-3-carboxylic acid ethyl ester is a chemical compound derived from quinoline, specifically an ethyl ester form of 4-hydroxy-5,7-dimethyl-3-carboxyquinoline. This substituted quinoline derivative is known for its potential biological activity and pharmacological applications, making it a valuable asset in pharmaceutical research and drug development.
Uses
Used in Pharmaceutical Research and Drug Development:
4-Hydroxy-5,7-dimethyl-quinoline-3-carboxylic acid ethyl ester is used as a starting material for the synthesis of other biologically active compounds due to its potential antioxidant, anti-inflammatory, or antimicrobial properties. Its specific applications and potential effects are the subject of ongoing research and experimentation in the field of medicinal chemistry, with the aim of developing new drugs that can harness these properties for therapeutic benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 93514-84-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,5,1 and 4 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 93514-84:
(7*9)+(6*3)+(5*5)+(4*1)+(3*4)+(2*8)+(1*4)=142
142 % 10 = 2
So 93514-84-2 is a valid CAS Registry Number.
InChI:InChI=1/C14H15NO3/c1-4-18-14(17)10-7-15-11-6-8(2)5-9(3)12(11)13(10)16/h5-7H,4H2,1-3H3,(H,15,16)