93783-29-0 Usage
General Description
1-(2-Aminoethyl)-4,5-dihydro-3-methyl-2-pentadecyl-1H-imidazolium methyl sulphate is a chemical compound consisting of a cationic imidazolium moiety and a methyl sulfate anion. It is a type of ionic liquid with potential applications in various fields such as catalysis, materials science, and pharmaceuticals. The compound is known for its unique physicochemical properties, including low melting point, high thermal stability, and tunable solubility in organic solvents. It can be synthesized through a multistep process involving the reaction of imidazole with alkyl halides and subsequent quaternization with methyl sulfate. Due to its interesting properties, 1-(2-Aminoethyl)-4,5-dihydro-3-methyl-2-pentadecyl-1H-imidazolium methyl sulphate is a subject of ongoing research for its potential use in various industrial and scientific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 93783-29-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,7,8 and 3 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 93783-29:
(7*9)+(6*3)+(5*7)+(4*8)+(3*3)+(2*2)+(1*9)=170
170 % 10 = 0
So 93783-29-0 is a valid CAS Registry Number.
InChI:InChI=1/C21H45N3.CH4O4S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-23(2)19-20-24(21)18-17-22;1-5-6(2,3)4/h21H,3-20,22H2,1-2H3;1H3,(H,2,3,4)