93858-07-2 Usage
Molecular structure
2-[2-[(2,3-dihydro-3-oxo-1H-indazol-6-yl)amino]-2-oxoethyl]icosenoic acid has a complex structure that includes a 1H-indazol-6-ylamine group and a long chain of icosanoic acid.
Oxoethyl group
The presence of an oxoethyl group adds complexity to the molecular structure and may influence the chemical's properties and potential biological activity.
Dihydro-3-oxo moiety
The dihydro-3-oxo moiety is another complex part of the molecule that may contribute to the chemical's unique properties and potential biological role.
Long-chain fatty acid derivative
This chemical is a derivative of a long-chain fatty acid, specifically icosanoic acid, which may suggest its involvement in lipid-related processes or pathways.
Potential biological activity
2-[2-[(2,3-dihydro-3-oxo-1H-indazol-6-yl)amino]-2-oxoethyl]icosenoic acid may have biological activity, possibly as a lipid mediator or a signaling molecule in cellular processes.
Unknown function
The precise role and function of this chemical in biological systems are yet to be fully understood, indicating that further research is needed to determine its potential applications and significance.
Check Digit Verification of cas no
The CAS Registry Mumber 93858-07-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,8,5 and 8 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 93858-07:
(7*9)+(6*3)+(5*8)+(4*5)+(3*8)+(2*0)+(1*7)=172
172 % 10 = 2
So 93858-07-2 is a valid CAS Registry Number.
InChI:InChI=1/C29H45N3O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(29(35)36)21-27(33)30-24-19-20-25-26(22-24)31-32-28(25)34/h18-20,22H,2-17,21H2,1H3,(H,30,33)(H,35,36)(H2,31,32,34)