93923-92-3 Usage
Description
(2E,6Z)-dodeca-2,6-dienyl acetate, also known as E6Z12-16Ac, is a chemical compound that belongs to the class of organic compounds known as fatty acid esters. It is derived from dodecanoic acid and has a molecular formula of C16H28O2. (2E,6Z)-dodeca-2,6-dienyl acetate is characterized by its sweet, green, and fruity odor, which makes it a valuable component in the fragrance and flavor industry.
Uses
Used in Fragrance and Flavor Industry:
(2E,6Z)-dodeca-2,6-dienyl acetate is used as a fragrance and flavoring agent for its sweet, green, and fruity odor. It is commonly found in natural products such as fruits, flowers, and essential oils, contributing to the pleasant and complex scents and tastes of these products.
Used in Insect Pheromones:
In the insect world, (2E,6Z)-dodeca-2,6-dienyl acetate is used as a pheromone, serving as a chemical signal for mating and communication among certain species. This application highlights its importance in the biological realm, as it plays a crucial role in the survival and reproduction of various insect populations.
Check Digit Verification of cas no
The CAS Registry Mumber 93923-92-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,9,2 and 3 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 93923-92:
(7*9)+(6*3)+(5*9)+(4*2)+(3*3)+(2*9)+(1*2)=163
163 % 10 = 3
So 93923-92-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H24O2/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(2)15/h7-8,11-12H,3-6,9-10,13H2,1-2H3/b8-7+,12-11+
