93942-35-9 Usage
Chemical Structure
3-bromopropionate group attached to a 5-hydroxypentyl group
Properties
Reactivity:
Can undergo various chemical reactions, such as esterification and nucleophilic substitution
Versatility:
Useful as a building block in organic synthesis
Intermediate:
Valuable intermediate in the development of new compounds
Applications:
Used in the preparation of pharmaceuticals, agrochemicals, and other fine chemicals
Caution:
Requires careful handling due to potential hazards if not properly managed
This compound's combination of properties, including its reactivity, versatility, and applicability in various fields, underscores its significance in organic synthesis and chemical development. However, its handling demands caution to mitigate potential risks.
Check Digit Verification of cas no
The CAS Registry Mumber 93942-35-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,9,4 and 2 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 93942-35:
(7*9)+(6*3)+(5*9)+(4*4)+(3*2)+(2*3)+(1*5)=159
159 % 10 = 9
So 93942-35-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H15BrO3/c9-5-4-8(11)12-7-3-1-2-6-10/h10H,1-7H2
