94087-23-7 Usage
Description
2-[7-isopropyl-5-methylbicyclo[2.2.2]oct-5-en-2-yl]-1,3-dioxolane is a complex chemical compound characterized by its unique molecular structure. It features a dioxolane ring fused with a bicyclo[2.2.2]octane ring, along with isopropyl and methyl substituents attached to the bicyclic ring system. These structural elements confer distinct chemical properties to the compound, positioning it as a valuable and versatile entity in the realm of chemistry.
Uses
Used in Pharmaceutical Industry:
2-[7-isopropyl-5-methylbicyclo[2.2.2]oct-5-en-2-yl]-1,3-dioxolane serves as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with potential therapeutic applications, making it an essential component in medicinal chemistry.
Used in Organic Synthesis:
In the field of organic synthesis, 2-[7-isopropyl-5-methylbicyclo[2.2.2]oct-5-en-2-yl]-1,3-dioxolane is utilized as a building block for creating more complex organic molecules. Its presence in the synthesis process can lead to the formation of novel compounds with a range of applications, from materials science to specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 94087-23-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,0,8 and 7 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 94087-23:
(7*9)+(6*4)+(5*0)+(4*8)+(3*7)+(2*2)+(1*3)=147
147 % 10 = 7
So 94087-23-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H24O2/c1-9(2)12-7-11-8-14(13(12)6-10(11)3)15-16-4-5-17-15/h6,9,11-15H,4-5,7-8H2,1-3H3