944904-66-9 Usage
General Description
(6-Bromo-1h-indazol-3-yl)-acetic acid is a chemical compound with the molecular formula C10H7BrN2O2. It is a derivative of indazol, a heterocyclic aromatic organic compound. The presence of the bromine atom in the molecule gives it distinct chemical properties and potential applications. It is a carboxylic acid derivative, which means it contains a carboxyl group, and is commonly used in organic synthesis and medicinal chemistry. Its structure and properties make it useful for potential pharmaceutical applications, including as a building block in the synthesis of biologically active compounds. It has potential use in the development of novel drugs due to its specific chemical structure and properties. Overall, (6-Bromo-1h-indazol-3-yl)-acetic acid is a valuable chemical compound with potential medicinal and research applications.
Check Digit Verification of cas no
The CAS Registry Mumber 944904-66-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,4,9,0 and 4 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 944904-66:
(8*9)+(7*4)+(6*4)+(5*9)+(4*0)+(3*4)+(2*6)+(1*6)=199
199 % 10 = 9
So 944904-66-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H7BrN2O2/c10-5-1-2-6-7(3-5)11-12-8(6)4-9(13)14/h1-3H,4H2,(H,11,12)(H,13,14)
