946002-10-4 Usage
Description
5-Fluoropyridine-2-boronic acid is an organic compound that features a boron atom bonded to a pyridine ring with a fluorine atom at the 5-position. This unique structure endows it with versatile reactivity and properties, making it a valuable intermediate in organic synthesis and medicinal chemistry.
Uses
Used in Pharmaceutical Industry:
5-Fluoropyridine-2-boronic acid is used as a key reactant for the synthesis of 5-lipoxygenase-activating protein (FLAP) inhibitors. These inhibitors are important in the development of drugs targeting inflammatory and allergic diseases, as they help regulate the production of leukotrienes, which play a significant role in these conditions.
In the context of medicinal chemistry, 5-Fluoropyridine-2-boronic acid serves as a building block for the creation of various bioactive molecules. Its reactivity and the presence of the boronic acid group allow for the formation of stable and functionalized compounds, which can be further modified to enhance their therapeutic potential.
Additionally, the boronic acid functionality of 5-Fluoropyridine-2-boronic acid enables it to participate in Suzuki-Miyaura cross-coupling reactions, a widely used method for the formation of carbon-carbon bonds. This makes it a valuable component in the synthesis of complex organic molecules, including those with potential applications in materials science and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 946002-10-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,6,0,0 and 2 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 946002-10:
(8*9)+(7*4)+(6*6)+(5*0)+(4*0)+(3*2)+(2*1)+(1*0)=144
144 % 10 = 4
So 946002-10-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H5BFNO2/c7-4-1-2-5(6(9)10)8-3-4/h1-3,9-10H
