959246-81-2 Usage
General Description
4-(3-Fluorophenyl)piperidine-2,6-dione, also known as 3-Fluorophthalimide, is a chemical compound with the molecular formula C12H9NO3F. It is a white crystalline powder that is used in pharmaceutical research and development. 4-(3-FLUOROPHENYL)PIPERIDINE-2,6-DIONE has potential applications in the synthesis of various pharmaceutical intermediates and building blocks. It is also used as a reagent in organic chemical reactions, particularly in the formation of heterocycles and nitrogen-containing compounds. Additionally, 4-(3-Fluorophenyl)piperidine-2,6-dione is known to possess certain pharmacological activities, making it of interest in drug discovery and development. Overall, this compound has diverse potential applications in the fields of chemistry and medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 959246-81-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,9,2,4 and 6 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 959246-81:
(8*9)+(7*5)+(6*9)+(5*2)+(4*4)+(3*6)+(2*8)+(1*1)=222
222 % 10 = 2
So 959246-81-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H10FNO2/c12-9-3-1-2-7(4-9)8-5-10(14)13-11(15)6-8/h1-4,8H,5-6H2,(H,13,14,15)
