961-69-3 Usage
Description
Potassium (R)-[(3-ethoxy-1-methyl-3-oxoprop-1-enyl)amino]phenylacetate is a complex organic compound with a unique molecular structure. It is characterized by the presence of a potassium ion, an (R)-amino group, a 3-ethoxy-1-methyl-3-oxoprop-1-enyl group, and a phenylacetate moiety. Potassium (R)-[(3-ethoxy-1-methyl-3-oxoprop-1-enyl)amino]phenylacetate has potential applications in various fields due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
Potassium (R)-[(3-ethoxy-1-methyl-3-oxoprop-1-enyl)amino]phenylacetate is used as an intermediate in the synthesis of semisynthetic penicillins and cephalosporins. It plays a crucial role in the production of these important classes of antibiotics, which are widely used to treat a variety of bacterial infections.
Used in Chemical Synthesis:
Due to its unique structure, Potassium (R)-[(3-ethoxy-1-methyl-3-oxoprop-1-enyl)amino]phenylacetate can be used as a building block in the synthesis of other complex organic compounds. Its versatility makes it a valuable component in the development of new pharmaceuticals, agrochemicals, and other specialty chemicals.
Flammability and Explosibility
Nonflammable
Check Digit Verification of cas no
The CAS Registry Mumber 961-69-3 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 9,6 and 1 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 961-69:
(5*9)+(4*6)+(3*1)+(2*6)+(1*9)=93
93 % 10 = 3
So 961-69-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H17NO4.K/c1-3-19-12(16)9-10(2)15-13(14(17)18)11-7-5-4-6-8-11;/h4-9,13,15H,3H2,1-2H3,(H,17,18);/q;+1/p-1/b10-9-;