96202-56-1 Usage
General Description
5-Ethyl-1H-indole-2,3-dione is a chemical compound with the molecular formula C11H9NO2. It is a derivative of indole, a heterocyclic organic compound. This particular compound contains a 5-ethyl substitution and a dione functional group, which gives it unique chemical reactivity and potential applications. As a dione, it is likely to participate in various chemical reactions such as nucleophilic addition and oxidation. 5-Ethyl-1H-indole-2,3-dione may have uses in organic synthesis, pharmaceuticals, or other industrial processes due to its distinct structural features and potential reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 96202-56-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,6,2,0 and 2 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 96202-56:
(7*9)+(6*6)+(5*2)+(4*0)+(3*2)+(2*5)+(1*6)=131
131 % 10 = 1
So 96202-56-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H9NO2/c1-2-6-3-4-8-7(5-6)9(12)10(13)11-8/h3-5H,2H2,1H3,(H,11,12,13)