98476-16-5 Usage
Description
Ethyl 1-(3-chlorophenyl)-5-cyano-1H-pyrazole-4-carboxylate is a pyrazole derivative with the molecular formula C12H9ClN4O2. It features a cyano and ester functional group attached to the pyrazole ring, making it a versatile chemical compound for various applications in organic synthesis and medicinal chemistry.
Uses
Used in Organic Synthesis:
Ethyl 1-(3-chlorophenyl)-5-cyano-1H-pyrazole-4-carboxylate is used as a building block in organic synthesis for the creation of more complex molecules. Its unique structure allows for further chemical reactions and modifications, contributing to the development of novel compounds with specific properties.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, ethyl 1-(3-chlorophenyl)-5-cyano-1H-pyrazole-4-carboxylate is used as a starting material for the development of new pharmaceutical drugs. Its specific properties, such as the presence of a 3-chlorophenyl group and a cyano group, may provide potential therapeutic benefits and contribute to the discovery of innovative treatments for various diseases.
Used in Pharmaceutical Industry:
Ethyl 1-(3-chlorophenyl)-5-cyano-1H-pyrazole-4-carboxylate is used as a key intermediate in the synthesis of pharmaceutical compounds. Its unique structure and functional groups make it a valuable component in the development of new drugs with improved efficacy, safety, and selectivity.
Used in Research and Development:
Ethyl 1-(3-chlorophenyl)-5-cyano-1H-pyrazole-4-carboxylate is utilized in research and development for exploring its potential applications and properties. Scientists and researchers investigate its chemical behavior, reactivity, and interactions with other molecules to gain insights into its possible uses and benefits in various fields.
Overall, ethyl 1-(3-chlorophenyl)-5-cyano-1H-pyrazole-4-carboxylate is a promising chemical compound with diverse applications in organic synthesis, medicinal chemistry, pharmaceutical industry, and research and development. Its unique structure and functional groups make it a valuable asset for the development of new molecules and pharmaceutical drugs, contributing to advancements in various scientific and medical fields.
Check Digit Verification of cas no
The CAS Registry Mumber 98476-16-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,8,4,7 and 6 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 98476-16:
(7*9)+(6*8)+(5*4)+(4*7)+(3*6)+(2*1)+(1*6)=185
185 % 10 = 5
So 98476-16-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H10ClN3O2/c1-2-19-13(18)11-8-16-17(12(11)7-15)10-5-3-4-9(14)6-10/h3-6,8H,2H2,1H3
98476-16-5Relevant articles and documents
4-carboxy-1-phenyl-5-pyrazolecarboxamides in the production of hybrid cereal grain seed
-
, (2008/06/13)
Pollen formation in cereal grain plants is inhibited by application of a 4-carboxy(or derivative)-1-aryl-5-pyrazolecarboxamide. Production of hybrid seed is facilitated by use of the compounds.
Pollen formation inhibiting 1-phenyl-4-carboxy-5-pyrazolecarboxamides
-
, (2008/06/13)
Pollen formation in cereal grain plants is inhibited by application of a 4-carboxy(or derivative)-1-aryl-5-pyrazolecarboxamide. Production of hybrid seed is facilitated by use of the compounds.