99066-77-0 Usage
General Description
2-OXO-1,2-DIHYDRO-QUINAZOLINE-4-CARBOXYLIC ACID is a chemical compound with the molecular formula C9H8N2O3. It is a derivative of quinazoline, a six-membered aromatic ring fused to a diazine ring. 2-OXO-1,2-DIHYDRO-QUINAZOLINE-4-CARBOXYLIC ACID is a carboxylic acid, meaning it contains a functional group with a carbon atom double-bonded to an oxygen atom and single-bonded to a hydroxyl group. It also contains a ketone group, characterized by a carbon atom double-bonded to an oxygen atom. 2-OXO-1,2-DIHYDRO-QUINAZOLINE-4-CARBOXYLIC ACID has potential applications in medicinal chemistry and pharmaceuticals, as well as in chemical synthesis for the preparation of other organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 99066-77-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,9,0,6 and 6 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 99066-77:
(7*9)+(6*9)+(5*0)+(4*6)+(3*6)+(2*7)+(1*7)=180
180 % 10 = 0
So 99066-77-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H6N2O3/c12-8(13)7-5-3-1-2-4-6(5)10-9(14)11-7/h1-4H,(H,12,13)(H,10,11,14)