99878-76-9 Usage
General Description
4-Hydroxy-7,8-Dimethoxyquinoline is a chemical compound that belongs to the quinoline class of organic compounds. It is characterized by a quinoline structure with hydroxyl and dimethoxy functional groups attached to it. 4-Hydroxy-7,8-Dimethoxyquinoline has potential applications in the pharmaceutical industry as it exhibits anti-inflammatory and anti-microbial properties. Additionally, it has been studied for its potential use as an anti-cancer agent. Its unique chemical structure and biological properties make it an interesting compound for further research and potential use in various medical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 99878-76-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,9,8,7 and 8 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 99878-76:
(7*9)+(6*9)+(5*8)+(4*7)+(3*8)+(2*7)+(1*6)=229
229 % 10 = 9
So 99878-76-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H11NO3/c1-14-9-4-3-7-8(13)5-6-12-10(7)11(9)15-2/h3-6H,1-2H3,(H,12,13)
99878-76-9Relevant articles and documents
4(1H)-quinolone derivatives
-
, (2008/06/13)
Quinolone derivatives having a quinolone structure: STR1 where Yo is O or S are disclosed, which are useful as cardiotonic agents. Typical examples of the quinolone derivatives include: 6,7-dimethoxy-4 (1H) quinolone (compound 6) and 5-hydroxy-6-methoxy-4(1H) quinolone (compound 1) as typical compounds of the formulae[I] and [I'], respectively, shown in the specification.
