The (6-Chloro-pyridazin-3-yl)-dimethyl-amine is an organic compound with the formula C₆H₈ClN₃. The IUPAC name of this chemical is 6-chloro-N,N-dimethylpyridazin-3-amine. With the CAS registry number 7145-60-0, it is also named as 3-Pyridazinamine, 6-chloro-N,N-dimethyl-. In addition, the molecular weight is 157.6.

The other characteristics of (6-Chloro-pyridazin-3-yl)-dimethyl-amine can be summarized as: (1)ACD/LogP: 0.97; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 3; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 1; (6)Polar Surface Area: 29.02 Å²; (7)Index of Refraction: 1.576; (8)Molar Refractivity: 41.64 cm³; (9)Molar Volume: 125.8 cm³; (10)Polarizability: 16.5×10^-24 cm³; (11)Surface Tension: 49.3 dyne/cm; (12)Density: 1.252 g/cm³; (13)Flash Point: 139.7 °C; (14)Enthalpy of Vaporization: 54.79 kJ/mol; (15)Boiling Point: 307.3 °C at 760 mmHg; (16)Vapour Pressure: 0.000729 mmHg at 25°C; (17)Rotatable Bond Count: 1; (18)Exact Mass: 157.040675; (19)MonoIsotopic Mass: 157.040675; (20)Topological Polar Surface Area: 29; (21)Heavy Atom Count: 10; (22)Complexity: 107.

People can use the following data to convert to the molecule structure. 
1. SMILES:Clc1nnc(N(C)C)cc1
2. InChI:InChI=1/C6H8ClN3/c1-10(2)6-4-3-5(7)8-9-6/h3-4H,1-2H3
3. InChIKey:APSLTSHWUCNYLS-UHFFFAOYAR
4. Std. InChI:InChI=1S/C6H8ClN3/c1-10(2)6-4-3-5(7)8-9-6/h3-4H,1-2H3
5. Std. InChIKey:APSLTSHWUCNYLS-UHFFFAOYSA-N