The 1-[Bis(2-methylphenyl)methyl]-2-methyl-benzene has the CAS registry number 6270-89-9. This chemical's molecular formula is C₂₂H₂₂ and molecular weight is 286.41. What's more, its systematic name is 1,1',1''-methanetriyltris(2-methylbenzene).

Physical properties of 1-[Bis(2-methylphenyl)methyl]-2-methyl-benzene are: (1)ACD/LogP: 7.07; (2)# of Rule of 5 Violations: 1; (3)#Freely Rotating Bonds: 3; (4)Index of Refraction: 1.585; (5)Molar Refractivity: 94.44 cm³; (6)Molar Volume: 281.5 cm³; (7)Polarizability: 37.44×10^-24cm³; (8)Surface Tension: 39.1 dyne/cm; (9)Density: 1.017 g/cm³; (10)Flash Point: 195.8 °C; (11)Enthalpy of Vaporization: 63.2 kJ/mol; (12)Boiling Point: 405.9 °C at 760 mmHg; (13)Vapour Pressure: 1.99E-06 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: c1(c(cccc1)C(c2ccccc2C)c3ccccc3C)C
(2)InChI: InChI=1S/C22H22/c1-16-10-4-7-13-19(16)22(20-14-8-5-11-17(20)2)21-15-9-6-12-18(21)3/h4-15,22H,1-3H3
(3)InChIKey: BLBXOCBWGVOOHG-UHFFFAOYSA-N